C25H18F6N2OS2 — CID 152700854
2,4-bis[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]pentan-3-one (PubChem CID 152700854) has the molecular formula C25H18F6N2OS2 and a molecular weight of 540.55 g/mol. Its IUPAC name is 2,4-bis[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]pentan-3-one.
| Compound Name | 2,4-bis[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]pentan-3-one |
|---|---|
| PubChem CID | 152700854 |
| Molecular Formula | C25H18F6N2OS2 |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | 2,4-bis[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]pentan-3-one |
| SMILES | CC(C(=O)C(C)c1cnc(-c2ccc(C(F)(F)F)cc2)s1)c1cnc(-c2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C25H18F6N2OS2/c1-13(19-11-32-22(35-19)15-3-7-17(8-4-15)24(26,27)28)21(34)14(2)20-12-33-23(36-20)16-5-9-18(10-6-16)25(29,30)31/h3-14H,1-2H3 |
| InChIKey | ZRNVZNFHHLFTRP-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |