About 1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol
1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol (PubChem CID 62651210) has the molecular formula C12H13NOS
and a molecular weight of 219.31 g/mol. Its IUPAC name is 1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol.
Molecular Properties
| Compound Name | 1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol |
| PubChem CID | 62651210 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol |
| SMILES | Cc1cccc(-c2ncc(C(C)O)s2)c1 |
| InChI | InChI=1S/C12H13NOS/c1-8-4-3-5-10(6-8)12-13-7-11(15-12)9(2)14/h3-7,9,14H,1-2H3 |
| InChIKey | CJEYTYTXLHHFDD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol?
The IUPAC name of 1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol (CID 62651210) is 1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol.
What is the SMILES notation for 1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol?
The canonical SMILES for 1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol is Cc1cccc(-c2ncc(C(C)O)s2)c1.
What is the InChIKey of 1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol?
The InChIKey is CJEYTYTXLHHFDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NOS/c1-8-4-3-5-10(6-8)12-13-7-11(15-12)9(2)14/h3-7,9,14H,1-2H3.
What are the key properties of 1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol?
1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol has a molecular weight of 219.31 g/mol, XLogP of 3.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3-methylphenyl)-1,3-thiazol-5-yl]ethanol is sourced from PubChem (CID 62651210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).