C12H12FNOS — CID 62653769
1-[2-(3-fluoro-4-methylphenyl)-1,3-thiazol-5-yl]ethanol (PubChem CID 62653769) has the molecular formula C12H12FNOS and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-[2-(3-fluoro-4-methylphenyl)-1,3-thiazol-5-yl]ethanol.
| Compound Name | 1-[2-(3-fluoro-4-methylphenyl)-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 62653769 |
| Molecular Formula | C12H12FNOS |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 1-[2-(3-fluoro-4-methylphenyl)-1,3-thiazol-5-yl]ethanol |
| SMILES | Cc1ccc(-c2ncc(C(C)O)s2)cc1F |
| InChI | InChI=1S/C12H12FNOS/c1-7-3-4-9(5-10(7)13)12-14-6-11(16-12)8(2)15/h3-6,8,15H,1-2H3 |
| InChIKey | NMRYTYJSNBZELM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |