C11H8F3NOS — CID 66939465
[5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]methanol (PubChem CID 66939465) has the molecular formula C11H8F3NOS and a molecular weight of 259.25 g/mol. Its IUPAC name is [5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]methanol.
| Compound Name | [5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]methanol |
|---|---|
| PubChem CID | 66939465 |
| Molecular Formula | C11H8F3NOS |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | [5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]methanol |
| SMILES | OCc1ncc(-c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C11H8F3NOS/c12-11(13,14)8-3-1-2-7(4-8)9-5-15-10(6-16)17-9/h1-5,16H,6H2 |
| InChIKey | VTWUDOXENAUREO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |