C11H7BF3NOS — CID 89139091
CID 89139091 (PubChem CID 89139091) has the molecular formula C11H7BF3NOS and a molecular weight of 269.06 g/mol.
| Compound Name | CID 89139091 |
|---|---|
| PubChem CID | 89139091 |
| Molecular Formula | C11H7BF3NOS |
| Molecular Weight | 269.06 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | — |
| SMILES | [B]c1sc(-c2cccc(C(F)(F)F)c2)nc1CO |
| InChI | InChI=1S/C11H7BF3NOS/c12-9-8(5-17)16-10(18-9)6-2-1-3-7(4-6)11(13,14)15/h1-4,17H,5H2 |
| InChIKey | VFNZWWZTEYVCLL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.06 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|