C16H11ClF3NS2 — CID 69455253
5-(chloromethyl)-4-(thiophen-3-ylmethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole (PubChem CID 69455253) has the molecular formula C16H11ClF3NS2 and a molecular weight of 373.85 g/mol. Its IUPAC name is 5-(chloromethyl)-4-(thiophen-3-ylmethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole.
| Compound Name | 5-(chloromethyl)-4-(thiophen-3-ylmethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 69455253 |
| Molecular Formula | C16H11ClF3NS2 |
| Molecular Weight | 373.85 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 5-(chloromethyl)-4-(thiophen-3-ylmethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole |
| SMILES | FC(F)(F)c1cccc(-c2nc(Cc3ccsc3)c(CCl)s2)c1 |
| InChI | InChI=1S/C16H11ClF3NS2/c17-8-14-13(6-10-4-5-22-9-10)21-15(23-14)11-2-1-3-12(7-11)16(18,19)20/h1-5,7,9H,6,8H2 |
| InChIKey | ZJWPBAJDAJVOOF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.85 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|