C26H24N6O2S — CID 165154330
[1-methyl-4-[5-(1-methylindazol-6-yl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-10-yl]pyrrol-2-yl]-morpholin-4-ylmethanone (PubChem CID 165154330) has the molecular formula C26H24N6O2S and a molecular weight of 484.59 g/mol. Its IUPAC name is [1-methyl-4-[5-(1-methylindazol-6-yl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-10-yl]pyrrol-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-methyl-4-[5-(1-methylindazol-6-yl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-10-yl]pyrrol-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 165154330 |
| Molecular Formula | C26H24N6O2S |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | [1-methyl-4-[5-(1-methylindazol-6-yl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-10-yl]pyrrol-2-yl]-morpholin-4-ylmethanone |
| SMILES | Cn1cc(-c2cc3c(s2)Cc2c(-c4ccc5cnn(C)c5c4)n[nH]c2-3)cc1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C26H24N6O2S/c1-30-14-17(10-21(30)26(33)32-5-7-34-8-6-32)22-11-18-23(35-22)12-19-24(28-29-25(18)19)15-3-4-16-13-27-31(2)20(16)9-15/h3-4,9-11,13-14H,5-8,12H2,1-2H3,(H,28,29) |
| InChIKey | VQWHGULDNQXRFW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 80.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |