C12H9N3O3 — CID 117359203
5-(1-methylindazol-6-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 117359203) has the molecular formula C12H9N3O3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 5-(1-methylindazol-6-yl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(1-methylindazol-6-yl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117359203 |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 5-(1-methylindazol-6-yl)-1,2-oxazole-3-carboxylic acid |
| SMILES | Cn1ncc2ccc(-c3cc(C(=O)O)no3)cc21 |
| InChI | InChI=1S/C12H9N3O3/c1-15-10-4-7(2-3-8(10)6-13-15)11-5-9(12(16)17)14-18-11/h2-6H,1H3,(H,16,17) |
| InChIKey | RAWXTPOARYAJLP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |