5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid

C12H7NO4 — CID 117329817

IUPAC5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc3ccoc3c2)on1
InChIInChI=1S/C12H7NO4/c14-12(15)9-6-11(17-13-9)8-2-1-7-3-4-16-10(7)5-8/h1-6H,(H,14,15)
InChIKeyJRZZWQMJBUOGAP-UHFFFAOYSA-N
MW229.19 g/mol
LogP2.79
Rot. Bonds2

About 5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid

5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 117329817) has the molecular formula C12H7NO4 and a molecular weight of 229.19 g/mol. Its IUPAC name is 5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid
PubChem CID117329817
Molecular FormulaC12H7NO4
Molecular Weight229.19 g/mol
Exact Mass229.04
IUPAC Name5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc3ccoc3c2)on1
InChIInChI=1S/C12H7NO4/c14-12(15)9-6-11(17-13-9)8-2-1-7-3-4-16-10(7)5-8/h1-6H,(H,14,15)
InChIKeyJRZZWQMJBUOGAP-UHFFFAOYSA-N
XLogP2.79
TPSA76.47 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.19
LogP ≤ 52.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid (CID 117329817) is 5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid is O=C(O)c1cc(-c2ccc3ccoc3c2)on1.
What is the InChIKey of 5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is JRZZWQMJBUOGAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO4/c14-12(15)9-6-11(17-13-9)8-2-1-7-3-4-16-10(7)5-8/h1-6H,(H,14,15).
What are the key properties of 5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid?
5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 229.19 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-benzofuran-6-yl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 117329817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).