C12H7NO4 — CID 117329819
5-(1-benzofuran-4-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 117329819) has the molecular formula C12H7NO4 and a molecular weight of 229.19 g/mol. Its IUPAC name is 5-(1-benzofuran-4-yl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(1-benzofuran-4-yl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117329819 |
| Molecular Formula | C12H7NO4 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 5-(1-benzofuran-4-yl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cccc3occc23)on1 |
| InChI | InChI=1S/C12H7NO4/c14-12(15)9-6-11(17-13-9)7-2-1-3-10-8(7)4-5-16-10/h1-6H,(H,14,15) |
| InChIKey | NNEMFLJMRWKKOI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |