C10H6INO4 — CID 155392679
5-(3-hydroxy-4-iodophenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 155392679) has the molecular formula C10H6INO4 and a molecular weight of 331.07 g/mol. Its IUPAC name is 5-(3-hydroxy-4-iodophenyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(3-hydroxy-4-iodophenyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 155392679 |
| Molecular Formula | C10H6INO4 |
| Molecular Weight | 331.07 g/mol |
| Exact Mass | 330.93 |
| IUPAC Name | 5-(3-hydroxy-4-iodophenyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(I)c(O)c2)on1 |
| InChI | InChI=1S/C10H6INO4/c11-6-2-1-5(3-8(6)13)9-4-7(10(14)15)12-16-9/h1-4,13H,(H,14,15) |
| InChIKey | IWUSAJVPVJOEHD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.07 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|