C15H13N3O4 — CID 71284595
4-hydroxy-5-methyl-6-(1-methylindazol-6-yl)-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 71284595) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is 4-hydroxy-5-methyl-6-(1-methylindazol-6-yl)-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 4-hydroxy-5-methyl-6-(1-methylindazol-6-yl)-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 71284595 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-hydroxy-5-methyl-6-(1-methylindazol-6-yl)-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | Cc1c(-c2ccc3cnn(C)c3c2)[nH]c(=O)c(C(=O)O)c1O |
| InChI | InChI=1S/C15H13N3O4/c1-7-12(17-14(20)11(13(7)19)15(21)22)8-3-4-9-6-16-18(2)10(9)5-8/h3-6H,1-2H3,(H,21,22)(H2,17,19,20) |
| InChIKey | QIGVXAHJNHKDMG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |