C23H27ClN6OSi — CID 58540832
5-(3-chloro-2-pyridinyl)-N-(6-methylpyridazin-3-yl)-1-(2-trimethylsilylethoxymethyl)indazol-3-amine (PubChem CID 58540832) has the molecular formula C23H27ClN6OSi and a molecular weight of 467.05 g/mol. Its IUPAC name is 5-(3-chloro-2-pyridinyl)-N-(6-methylpyridazin-3-yl)-1-(2-trimethylsilylethoxymethyl)indazol-3-amine.
| Compound Name | 5-(3-chloro-2-pyridinyl)-N-(6-methylpyridazin-3-yl)-1-(2-trimethylsilylethoxymethyl)indazol-3-amine |
|---|---|
| PubChem CID | 58540832 |
| Molecular Formula | C23H27ClN6OSi |
| Molecular Weight | 467.05 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 5-(3-chloro-2-pyridinyl)-N-(6-methylpyridazin-3-yl)-1-(2-trimethylsilylethoxymethyl)indazol-3-amine |
| SMILES | Cc1ccc(Nc2nn(COCC[Si](C)(C)C)c3ccc(-c4ncccc4Cl)cc23)nn1 |
| InChI | InChI=1S/C23H27ClN6OSi/c1-16-7-10-21(28-27-16)26-23-18-14-17(22-19(24)6-5-11-25-22)8-9-20(18)30(29-23)15-31-12-13-32(2,3)4/h5-11,14H,12-13,15H2,1-4H3,(H,26,28,29) |
| InChIKey | WDGFCIXVZDSOMB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.05 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|