C21H23ClFN5OSi — CID 87277336
5-chloro-3-(6-fluoroquinolin-3-yl)-N-(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 87277336) has the molecular formula C21H23ClFN5OSi and a molecular weight of 443.99 g/mol. Its IUPAC name is 5-chloro-3-(6-fluoroquinolin-3-yl)-N-(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-3-(6-fluoroquinolin-3-yl)-N-(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 87277336 |
| Molecular Formula | C21H23ClFN5OSi |
| Molecular Weight | 443.99 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 5-chloro-3-(6-fluoroquinolin-3-yl)-N-(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCNc1cc(Cl)nc2c(-c3cnc4ccc(F)cc4c3)cnn12 |
| InChI | InChI=1S/C21H23ClFN5OSi/c1-30(2,3)7-6-29-13-25-20-10-19(22)27-21-17(12-26-28(20)21)15-8-14-9-16(23)4-5-18(14)24-11-15/h4-5,8-12,25H,6-7,13H2,1-3H3 |
| InChIKey | PPXLRZFVRFBPNB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.99 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|