C23H29FN2O3Si — CID 90075794
2-[[4-[(3-fluoro-5-phenylmethoxyphenoxy)methyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 90075794) has the molecular formula C23H29FN2O3Si and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-[[4-[(3-fluoro-5-phenylmethoxyphenoxy)methyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[(3-fluoro-5-phenylmethoxyphenoxy)methyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 90075794 |
| Molecular Formula | C23H29FN2O3Si |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 2-[[4-[(3-fluoro-5-phenylmethoxyphenoxy)methyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cnc(COc2cc(F)cc(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H29FN2O3Si/c1-30(2,3)10-9-27-18-26-14-21(25-17-26)16-29-23-12-20(24)11-22(13-23)28-15-19-7-5-4-6-8-19/h4-8,11-14,17H,9-10,15-16,18H2,1-3H3 |
| InChIKey | IXCIDNDEMDCATK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|