C23H45NO2SiSn — CID 175958741
trimethyl-[2-[(2-tributylstannyl-3-pyridinyl)oxymethoxy]ethyl]silane (PubChem CID 175958741) has the molecular formula C23H45NO2SiSn and a molecular weight of 514.42 g/mol. Its IUPAC name is trimethyl-[2-[(2-tributylstannyl-3-pyridinyl)oxymethoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[(2-tributylstannyl-3-pyridinyl)oxymethoxy]ethyl]silane |
|---|---|
| PubChem CID | 175958741 |
| Molecular Formula | C23H45NO2SiSn |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | trimethyl-[2-[(2-tributylstannyl-3-pyridinyl)oxymethoxy]ethyl]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ncccc1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C11H18NO2Si.3C4H9.Sn/c1-15(2,3)8-7-13-10-14-11-5-4-6-12-9-11;3*1-3-4-2;/h4-6H,7-8,10H2,1-3H3;3*1,3-4H2,2H3; |
| InChIKey | KSJTYPHCJLZGMF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|