C13H20BrN3OSi — CID 172723954
2-[[5-(bromomethyl)benzotriazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 172723954) has the molecular formula C13H20BrN3OSi and a molecular weight of 342.31 g/mol. Its IUPAC name is 2-[[5-(bromomethyl)benzotriazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(bromomethyl)benzotriazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 172723954 |
| Molecular Formula | C13H20BrN3OSi |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 2-[[5-(bromomethyl)benzotriazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nnc2cc(CBr)ccc21 |
| InChI | InChI=1S/C13H20BrN3OSi/c1-19(2,3)7-6-18-10-17-13-5-4-11(9-14)8-12(13)15-16-17/h4-5,8H,6-7,9-10H2,1-3H3 |
| InChIKey | GWVBHKOSORIIML-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|