C21H28BrN3O3SSi — CID 140700601
N-[2-bromo-4-(methylsulfonylmethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)indazol-5-amine (PubChem CID 140700601) has the molecular formula C21H28BrN3O3SSi and a molecular weight of 510.53 g/mol. Its IUPAC name is N-[2-bromo-4-(methylsulfonylmethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)indazol-5-amine.
| Compound Name | N-[2-bromo-4-(methylsulfonylmethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)indazol-5-amine |
|---|---|
| PubChem CID | 140700601 |
| Molecular Formula | C21H28BrN3O3SSi |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | N-[2-bromo-4-(methylsulfonylmethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)indazol-5-amine |
| SMILES | C[Si](C)(C)CCOCn1ncc2cc(Nc3ccc(CS(C)(=O)=O)cc3Br)ccc21 |
| InChI | InChI=1S/C21H28BrN3O3SSi/c1-29(26,27)14-16-5-7-20(19(22)11-16)24-18-6-8-21-17(12-18)13-23-25(21)15-28-9-10-30(2,3)4/h5-8,11-13,24H,9-10,14-15H2,1-4H3 |
| InChIKey | RVPGGESSWFXSRF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|