C20H25IN2O2Si — CID 125481141
(R)-(4-iodophenyl)-[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]methanol (PubChem CID 125481141) has the molecular formula C20H25IN2O2Si and a molecular weight of 480.42 g/mol. Its IUPAC name is (R)-(4-iodophenyl)-[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]methanol.
| Compound Name | (R)-(4-iodophenyl)-[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]methanol |
|---|---|
| PubChem CID | 125481141 |
| Molecular Formula | C20H25IN2O2Si |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | (R)-(4-iodophenyl)-[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]methanol |
| SMILES | C[Si](C)(C)CCOCn1ncc2cc([C@H](O)c3ccc(I)cc3)ccc21 |
| InChI | InChI=1S/C20H25IN2O2Si/c1-26(2,3)11-10-25-14-23-19-9-6-16(12-17(19)13-22-23)20(24)15-4-7-18(21)8-5-15/h4-9,12-13,20,24H,10-11,14H2,1-3H3/t20-/m1/s1 |
| InChIKey | AXBZTKNETUZIJT-HXUWFJFHSA-N |
| XLogP | 5.03 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|