C24H29FIN3OSi — CID 155640242
2-[[5-(4-fluorophenyl)-7-iodo-6-propan-2-ylpyrrolo[2,3-f]indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 155640242) has the molecular formula C24H29FIN3OSi and a molecular weight of 549.50 g/mol. Its IUPAC name is 2-[[5-(4-fluorophenyl)-7-iodo-6-propan-2-ylpyrrolo[2,3-f]indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(4-fluorophenyl)-7-iodo-6-propan-2-ylpyrrolo[2,3-f]indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 155640242 |
| Molecular Formula | C24H29FIN3OSi |
| Molecular Weight | 549.50 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | 2-[[5-(4-fluorophenyl)-7-iodo-6-propan-2-ylpyrrolo[2,3-f]indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC(C)c1c(I)c2cc3c(cnn3COCC[Si](C)(C)C)cc2n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H29FIN3OSi/c1-16(2)24-23(26)20-13-21-17(14-27-28(21)15-30-10-11-31(3,4)5)12-22(20)29(24)19-8-6-18(25)7-9-19/h6-9,12-14,16H,10-11,15H2,1-5H3 |
| InChIKey | LDJFAWUCXVPCOW-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.50 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|