C30H48F3N3O5SSi — CID 176890364
tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]butyl]sulfanylbutanoate (PubChem CID 176890364) has the molecular formula C30H48F3N3O5SSi and a molecular weight of 647.88 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]butyl]sulfanylbutanoate.
| Compound Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]butyl]sulfanylbutanoate |
|---|---|
| PubChem CID | 176890364 |
| Molecular Formula | C30H48F3N3O5SSi |
| Molecular Weight | 647.88 g/mol |
| Exact Mass | 647.30 |
| IUPAC Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]butyl]sulfanylbutanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCSCCC(c1ccc2c(cnn2COCC[Si](C)(C)C)c1)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H48F3N3O5SSi/c1-28(2,3)40-26(37)24(35-27(38)41-29(4,5)6)13-16-42-15-12-23(30(31,32)33)21-10-11-25-22(18-21)19-34-36(25)20-39-14-17-43(7,8)9/h10-11,18-19,23-24H,12-17,20H2,1-9H3,(H,35,38)/t23?,24-/m0/s1 |
| InChIKey | JDVDSULNIYMRMT-CGAIIQECSA-N |
| XLogP | 7.74 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.88 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|