C19H31F3N4O4S — CID 170770578
tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-(triazol-2-yl)butyl]sulfanylbutanoate (PubChem CID 170770578) has the molecular formula C19H31F3N4O4S and a molecular weight of 468.54 g/mol. Its IUPAC name is tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-(triazol-2-yl)butyl]sulfanylbutanoate.
| Compound Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-(triazol-2-yl)butyl]sulfanylbutanoate |
|---|---|
| PubChem CID | 170770578 |
| Molecular Formula | C19H31F3N4O4S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-(triazol-2-yl)butyl]sulfanylbutanoate |
| SMILES | CC(C)(C)OC(=O)NC(CCSCCC(n1nccn1)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H31F3N4O4S/c1-17(2,3)29-15(27)13(25-16(28)30-18(4,5)6)7-11-31-12-8-14(19(20,21)22)26-23-9-10-24-26/h9-10,13-14H,7-8,11-12H2,1-6H3,(H,25,28) |
| InChIKey | BBJOUEUJDXDUKR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|