C23H35F3N2O5S — CID 170770042
tert-butyl (2S)-4-[3-(4-aminophenyl)-4,4,4-trifluoro-3-hydroxybutyl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 170770042) has the molecular formula C23H35F3N2O5S and a molecular weight of 508.60 g/mol. Its IUPAC name is tert-butyl (2S)-4-[3-(4-aminophenyl)-4,4,4-trifluoro-3-hydroxybutyl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | tert-butyl (2S)-4-[3-(4-aminophenyl)-4,4,4-trifluoro-3-hydroxybutyl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 170770042 |
| Molecular Formula | C23H35F3N2O5S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | tert-butyl (2S)-4-[3-(4-aminophenyl)-4,4,4-trifluoro-3-hydroxybutyl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCSCCC(O)(c1ccc(N)cc1)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H35F3N2O5S/c1-20(2,3)32-18(29)17(28-19(30)33-21(4,5)6)11-13-34-14-12-22(31,23(24,25)26)15-7-9-16(27)10-8-15/h7-10,17,31H,11-14,27H2,1-6H3,(H,28,30)/t17-,22?/m0/s1 |
| InChIKey | MCHJLUWSELUYGD-LBOXEOMUSA-N |
| XLogP | 4.77 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|