C15H20Cl2N2O4S — CID 4598855
methyl 4-[(2,6-dichloro-4-pyridinyl)sulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 4598855) has the molecular formula C15H20Cl2N2O4S and a molecular weight of 395.31 g/mol. Its IUPAC name is methyl 4-[(2,6-dichloro-4-pyridinyl)sulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | methyl 4-[(2,6-dichloro-4-pyridinyl)sulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 4598855 |
| Molecular Formula | C15H20Cl2N2O4S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | methyl 4-[(2,6-dichloro-4-pyridinyl)sulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COC(=O)C(CCSc1cc(Cl)nc(Cl)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20Cl2N2O4S/c1-15(2,3)23-14(21)18-10(13(20)22-4)5-6-24-9-7-11(16)19-12(17)8-9/h7-8,10H,5-6H2,1-4H3,(H,18,21) |
| InChIKey | GLRGYTBVQQBOPI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|