C19H24N2O4Si — CID 10690680
3-methoxy-4-[1-(2-trimethylsilylethoxymethyl)indol-3-yl]pyrrole-2,5-dione (PubChem CID 10690680) has the molecular formula C19H24N2O4Si and a molecular weight of 372.50 g/mol. Its IUPAC name is 3-methoxy-4-[1-(2-trimethylsilylethoxymethyl)indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-methoxy-4-[1-(2-trimethylsilylethoxymethyl)indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 10690680 |
| Molecular Formula | C19H24N2O4Si |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-methoxy-4-[1-(2-trimethylsilylethoxymethyl)indol-3-yl]pyrrole-2,5-dione |
| SMILES | COC1=C(c2cn(COCC[Si](C)(C)C)c3ccccc23)C(=O)NC1=O |
| InChI | InChI=1S/C19H24N2O4Si/c1-24-17-16(18(22)20-19(17)23)14-11-21(12-25-9-10-26(2,3)4)15-8-6-5-7-13(14)15/h5-8,11H,9-10,12H2,1-4H3,(H,20,22,23) |
| InChIKey | AFEYSJUPLMKYKG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|