C27H29N3O3Si — CID 25215540
3-(1H-indol-3-yl)-1-methyl-4-[1-(2-trimethylsilylethoxymethyl)indol-3-yl]pyrrole-2,5-dione (PubChem CID 25215540) has the molecular formula C27H29N3O3Si and a molecular weight of 471.63 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-1-methyl-4-[1-(2-trimethylsilylethoxymethyl)indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1H-indol-3-yl)-1-methyl-4-[1-(2-trimethylsilylethoxymethyl)indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 25215540 |
| Molecular Formula | C27H29N3O3Si |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 3-(1H-indol-3-yl)-1-methyl-4-[1-(2-trimethylsilylethoxymethyl)indol-3-yl]pyrrole-2,5-dione |
| SMILES | CN1C(=O)C(c2c[nH]c3ccccc23)=C(c2cn(COCC[Si](C)(C)C)c3ccccc23)C1=O |
| InChI | InChI=1S/C27H29N3O3Si/c1-29-26(31)24(20-15-28-22-11-7-5-9-18(20)22)25(27(29)32)21-16-30(17-33-13-14-34(2,3)4)23-12-8-6-10-19(21)23/h5-12,15-16,28H,13-14,17H2,1-4H3 |
| InChIKey | ZKRFEULLWKDFHP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|