C29H28N4O5 — CID 46933956
methyl (2S)-2-[[2-[3-[4-(1H-indol-3-yl)-1-methyl-2,5-dioxopyrrol-3-yl]indol-1-yl]acetyl]amino]-3-methylbutanoate (PubChem CID 46933956) has the molecular formula C29H28N4O5 and a molecular weight of 512.57 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[3-[4-(1H-indol-3-yl)-1-methyl-2,5-dioxopyrrol-3-yl]indol-1-yl]acetyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[2-[3-[4-(1H-indol-3-yl)-1-methyl-2,5-dioxopyrrol-3-yl]indol-1-yl]acetyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 46933956 |
| Molecular Formula | C29H28N4O5 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | methyl (2S)-2-[[2-[3-[4-(1H-indol-3-yl)-1-methyl-2,5-dioxopyrrol-3-yl]indol-1-yl]acetyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)Cn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)N(C)C2=O)c2ccccc21)C(C)C |
| InChI | InChI=1S/C29H28N4O5/c1-16(2)26(29(37)38-4)31-23(34)15-33-14-20(18-10-6-8-12-22(18)33)25-24(27(35)32(3)28(25)36)19-13-30-21-11-7-5-9-17(19)21/h5-14,16,26,30H,15H2,1-4H3,(H,31,34)/t26-/m0/s1 |
| InChIKey | RCDPOUYKSYIPEE-SANMLTNESA-N |
| XLogP | 3.35 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|