C27H25N3O5 — CID 102019849
2-[2-[3-[4-(1H-indol-3-yl)-1-methyl-2,5-dioxopyrrol-3-yl]indol-1-yl]ethoxy]ethyl acetate (PubChem CID 102019849) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is 2-[2-[3-[4-(1H-indol-3-yl)-1-methyl-2,5-dioxopyrrol-3-yl]indol-1-yl]ethoxy]ethyl acetate.
| Compound Name | 2-[2-[3-[4-(1H-indol-3-yl)-1-methyl-2,5-dioxopyrrol-3-yl]indol-1-yl]ethoxy]ethyl acetate |
|---|---|
| PubChem CID | 102019849 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 2-[2-[3-[4-(1H-indol-3-yl)-1-methyl-2,5-dioxopyrrol-3-yl]indol-1-yl]ethoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCCn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)N(C)C2=O)c2ccccc21 |
| InChI | InChI=1S/C27H25N3O5/c1-17(31)35-14-13-34-12-11-30-16-21(19-8-4-6-10-23(19)30)25-24(26(32)29(2)27(25)33)20-15-28-22-9-5-3-7-18(20)22/h3-10,15-16,28H,11-14H2,1-2H3 |
| InChIKey | YXXDHKPHFDFFNR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|