C25H21Cl2N3O2 — CID 23529129
3,4-bis[1-(2-chloroethyl)indol-3-yl]-1-methylpyrrole-2,5-dione (PubChem CID 23529129) has the molecular formula C25H21Cl2N3O2 and a molecular weight of 466.37 g/mol. Its IUPAC name is 3,4-bis[1-(2-chloroethyl)indol-3-yl]-1-methylpyrrole-2,5-dione.
| Compound Name | 3,4-bis[1-(2-chloroethyl)indol-3-yl]-1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 23529129 |
| Molecular Formula | C25H21Cl2N3O2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 3,4-bis[1-(2-chloroethyl)indol-3-yl]-1-methylpyrrole-2,5-dione |
| SMILES | CN1C(=O)C(c2cn(CCCl)c3ccccc23)=C(c2cn(CCCl)c3ccccc23)C1=O |
| InChI | InChI=1S/C25H21Cl2N3O2/c1-28-24(31)22(18-14-29(12-10-26)20-8-4-2-6-16(18)20)23(25(28)32)19-15-30(13-11-27)21-9-5-3-7-17(19)21/h2-9,14-15H,10-13H2,1H3 |
| InChIKey | CQYSDDNGYUKVHI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|