C22H16N2O3 — CID 14525661
3,4-bis(1-methylindol-3-yl)furan-2,5-dione (PubChem CID 14525661) has the molecular formula C22H16N2O3 and a molecular weight of 356.38 g/mol. Its IUPAC name is 3,4-bis(1-methylindol-3-yl)furan-2,5-dione.
| Compound Name | 3,4-bis(1-methylindol-3-yl)furan-2,5-dione |
|---|---|
| PubChem CID | 14525661 |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3,4-bis(1-methylindol-3-yl)furan-2,5-dione |
| SMILES | Cn1cc(C2=C(c3cn(C)c4ccccc34)C(=O)OC2=O)c2ccccc21 |
| InChI | InChI=1S/C22H16N2O3/c1-23-11-15(13-7-3-5-9-17(13)23)19-20(22(26)27-21(19)25)16-12-24(2)18-10-6-4-8-14(16)18/h3-12H,1-2H3 |
| InChIKey | ZQBMJJMHPOEJAM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|