C28H25N3O3 — CID 22850690
3-[(11S,15R)-13-methyl-1,13-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8-tetraen-8-yl]-4-(1-methylindol-3-yl)furan-2,5-dione (PubChem CID 22850690) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is 3-[(11S,15R)-13-methyl-1,13-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8-tetraen-8-yl]-4-(1-methylindol-3-yl)furan-2,5-dione.
| Compound Name | 3-[(11S,15R)-13-methyl-1,13-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8-tetraen-8-yl]-4-(1-methylindol-3-yl)furan-2,5-dione |
|---|---|
| PubChem CID | 22850690 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 3-[(11S,15R)-13-methyl-1,13-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8-tetraen-8-yl]-4-(1-methylindol-3-yl)furan-2,5-dione |
| SMILES | CN1C[C@H]2Cc3c(C4=C(c5cn(C)c6ccccc56)C(=O)OC4=O)c4ccccc4n3C[C@H]2C1 |
| InChI | InChI=1S/C28H25N3O3/c1-29-12-16-11-23-24(19-8-4-6-10-22(19)31(23)14-17(16)13-29)26-25(27(32)34-28(26)33)20-15-30(2)21-9-5-3-7-18(20)21/h3-10,15-17H,11-14H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | KCKJHMOUWDVKPH-IAGOWNOFSA-N |
| XLogP | 3.86 |
| TPSA | 56.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|