C25H20N2O5 — CID 15163046
2-[3-[4-(1-methylindol-3-yl)-2,5-dioxofuran-3-yl]indol-1-yl]ethyl acetate (PubChem CID 15163046) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is 2-[3-[4-(1-methylindol-3-yl)-2,5-dioxofuran-3-yl]indol-1-yl]ethyl acetate.
| Compound Name | 2-[3-[4-(1-methylindol-3-yl)-2,5-dioxofuran-3-yl]indol-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 15163046 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 2-[3-[4-(1-methylindol-3-yl)-2,5-dioxofuran-3-yl]indol-1-yl]ethyl acetate |
| SMILES | CC(=O)OCCn1cc(C2=C(c3cn(C)c4ccccc34)C(=O)OC2=O)c2ccccc21 |
| InChI | InChI=1S/C25H20N2O5/c1-15(28)31-12-11-27-14-19(17-8-4-6-10-21(17)27)23-22(24(29)32-25(23)30)18-13-26(2)20-9-5-3-7-16(18)20/h3-10,13-14H,11-12H2,1-2H3 |
| InChIKey | GCIVGLSCOADDKZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|