C24H21N3O2S — CID 18780279
3-(1-methylindol-3-yl)-4-[1-(3-sulfanylpropyl)indol-3-yl]pyrrole-2,5-dione (PubChem CID 18780279) has the molecular formula C24H21N3O2S and a molecular weight of 415.52 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-4-[1-(3-sulfanylpropyl)indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1-methylindol-3-yl)-4-[1-(3-sulfanylpropyl)indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18780279 |
| Molecular Formula | C24H21N3O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 3-(1-methylindol-3-yl)-4-[1-(3-sulfanylpropyl)indol-3-yl]pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3cn(CCCS)c4ccccc34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C24H21N3O2S/c1-26-13-17(15-7-2-4-9-19(15)26)21-22(24(29)25-23(21)28)18-14-27(11-6-12-30)20-10-5-3-8-16(18)20/h2-5,7-10,13-14,30H,6,11-12H2,1H3,(H,25,28,29) |
| InChIKey | SAYILAXGBWKJLI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|