C20H13N3O2 — CID 2399
3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 2399) has the molecular formula C20H13N3O2 and a molecular weight of 327.34 g/mol. Its IUPAC name is 3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 2399 |
| Molecular Formula | C20H13N3O2 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2c[nH]c3ccccc23)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H13N3O2/c24-19-17(13-9-21-15-7-3-1-5-11(13)15)18(20(25)23-19)14-10-22-16-8-4-2-6-12(14)16/h1-10,21-22H,(H,23,24,25) |
| InChIKey | DQYBRTASHMYDJG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|