C26H23N3O4 — CID 11166603
tert-butyl 3-[4-(1H-indol-3-yl)-1-methyl-2,5-dioxopyrrol-3-yl]indole-1-carboxylate (PubChem CID 11166603) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is tert-butyl 3-[4-(1H-indol-3-yl)-1-methyl-2,5-dioxopyrrol-3-yl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(1H-indol-3-yl)-1-methyl-2,5-dioxopyrrol-3-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 11166603 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | tert-butyl 3-[4-(1H-indol-3-yl)-1-methyl-2,5-dioxopyrrol-3-yl]indole-1-carboxylate |
| SMILES | CN1C(=O)C(c2c[nH]c3ccccc23)=C(c2cn(C(=O)OC(C)(C)C)c3ccccc23)C1=O |
| InChI | InChI=1S/C26H23N3O4/c1-26(2,3)33-25(32)29-14-18(16-10-6-8-12-20(16)29)22-21(23(30)28(4)24(22)31)17-13-27-19-11-7-5-9-15(17)19/h5-14,27H,1-4H3 |
| InChIKey | JOKUANVZEPBCJI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|