C27H35NO2 — CID 175951991
tert-butyl 3-(3,5-ditert-butylphenyl)indole-1-carboxylate (PubChem CID 175951991) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is tert-butyl 3-(3,5-ditert-butylphenyl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-(3,5-ditert-butylphenyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 175951991 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | tert-butyl 3-(3,5-ditert-butylphenyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2ccccc21 |
| InChI | InChI=1S/C27H35NO2/c1-25(2,3)19-14-18(15-20(16-19)26(4,5)6)22-17-28(24(29)30-27(7,8)9)23-13-11-10-12-21(22)23/h10-17H,1-9H3 |
| InChIKey | DQUDMSPCTHLLFX-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |