C20H17F2NO5 — CID 167219665
tert-butyl 3-[5-(2,2-difluoro-3-oxopropanoyl)furan-3-yl]indole-1-carboxylate (PubChem CID 167219665) has the molecular formula C20H17F2NO5 and a molecular weight of 389.35 g/mol. Its IUPAC name is tert-butyl 3-[5-(2,2-difluoro-3-oxopropanoyl)furan-3-yl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[5-(2,2-difluoro-3-oxopropanoyl)furan-3-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 167219665 |
| Molecular Formula | C20H17F2NO5 |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | tert-butyl 3-[5-(2,2-difluoro-3-oxopropanoyl)furan-3-yl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(-c2coc(C(=O)C(F)(F)C=O)c2)c2ccccc21 |
| InChI | InChI=1S/C20H17F2NO5/c1-19(2,3)28-18(26)23-9-14(13-6-4-5-7-15(13)23)12-8-16(27-10-12)17(25)20(21,22)11-24/h4-11H,1-3H3 |
| InChIKey | ZWUBKHQUNIWZAX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|