C22H30N2O4SSi — CID 159174881
ethyl 2-[hydroxy-[1-(2-trimethylsilylethoxymethyl)indol-3-yl]methyl]-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 159174881) has the molecular formula C22H30N2O4SSi and a molecular weight of 446.65 g/mol. Its IUPAC name is ethyl 2-[hydroxy-[1-(2-trimethylsilylethoxymethyl)indol-3-yl]methyl]-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[hydroxy-[1-(2-trimethylsilylethoxymethyl)indol-3-yl]methyl]-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 159174881 |
| Molecular Formula | C22H30N2O4SSi |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | ethyl 2-[hydroxy-[1-(2-trimethylsilylethoxymethyl)indol-3-yl]methyl]-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(C(O)c2cn(COCC[Si](C)(C)C)c3ccccc23)sc1C |
| InChI | InChI=1S/C22H30N2O4SSi/c1-6-28-22(26)19-15(2)29-21(23-19)20(25)17-13-24(14-27-11-12-30(3,4)5)18-10-8-7-9-16(17)18/h7-10,13,20,25H,6,11-12,14H2,1-5H3 |
| InChIKey | KMDNKFVRHOFCSV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|