C24H28N2O3SSi — CID 158402235
4-[2-[1-(2-trimethylsilylethoxymethyl)indole-3-carbonyl]-1,3-thiazol-4-yl]cyclohex-3-en-1-one (PubChem CID 158402235) has the molecular formula C24H28N2O3SSi and a molecular weight of 452.65 g/mol. Its IUPAC name is 4-[2-[1-(2-trimethylsilylethoxymethyl)indole-3-carbonyl]-1,3-thiazol-4-yl]cyclohex-3-en-1-one.
| Compound Name | 4-[2-[1-(2-trimethylsilylethoxymethyl)indole-3-carbonyl]-1,3-thiazol-4-yl]cyclohex-3-en-1-one |
|---|---|
| PubChem CID | 158402235 |
| Molecular Formula | C24H28N2O3SSi |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 4-[2-[1-(2-trimethylsilylethoxymethyl)indole-3-carbonyl]-1,3-thiazol-4-yl]cyclohex-3-en-1-one |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)c2nc(C3=CCC(=O)CC3)cs2)c2ccccc21 |
| InChI | InChI=1S/C24H28N2O3SSi/c1-31(2,3)13-12-29-16-26-14-20(19-6-4-5-7-22(19)26)23(28)24-25-21(15-30-24)17-8-10-18(27)11-9-17/h4-8,14-15H,9-13,16H2,1-3H3 |
| InChIKey | GYGAPUYXAIWDAX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|