C15H13N4O5PS — CID 166829925
[3-[4-[amino(cyano)methyl]-1,3-thiazole-2-carbonyl]indol-1-yl]methyl dihydrogen phosphate (PubChem CID 166829925) has the molecular formula C15H13N4O5PS and a molecular weight of 392.33 g/mol. Its IUPAC name is [3-[4-[amino(cyano)methyl]-1,3-thiazole-2-carbonyl]indol-1-yl]methyl dihydrogen phosphate.
| Compound Name | [3-[4-[amino(cyano)methyl]-1,3-thiazole-2-carbonyl]indol-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 166829925 |
| Molecular Formula | C15H13N4O5PS |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | [3-[4-[amino(cyano)methyl]-1,3-thiazole-2-carbonyl]indol-1-yl]methyl dihydrogen phosphate |
| SMILES | N#CC(N)c1csc(C(=O)c2cn(COP(=O)(O)O)c3ccccc23)n1 |
| InChI | InChI=1S/C15H13N4O5PS/c16-5-11(17)12-7-26-15(18-12)14(20)10-6-19(8-24-25(21,22)23)13-4-2-1-3-9(10)13/h1-4,6-7,11H,8,17H2,(H2,21,22,23) |
| InChIKey | SIBCPPRLZFKZPD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|