C16H14FN2Na2O6PS — CID 162256803
disodium;[6-fluoro-3-[4-[(1S)-1-hydroxypropyl]-1,3-thiazole-2-carbonyl]indol-1-yl]methyl phosphate (PubChem CID 162256803) has the molecular formula C16H14FN2Na2O6PS and a molecular weight of 458.32 g/mol. Its IUPAC name is disodium;[6-fluoro-3-[4-[(1S)-1-hydroxypropyl]-1,3-thiazole-2-carbonyl]indol-1-yl]methyl phosphate.
| Compound Name | disodium;[6-fluoro-3-[4-[(1S)-1-hydroxypropyl]-1,3-thiazole-2-carbonyl]indol-1-yl]methyl phosphate |
|---|---|
| PubChem CID | 162256803 |
| Molecular Formula | C16H14FN2Na2O6PS |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | disodium;[6-fluoro-3-[4-[(1S)-1-hydroxypropyl]-1,3-thiazole-2-carbonyl]indol-1-yl]methyl phosphate |
| SMILES | CC[C@H](O)c1csc(C(=O)c2cn(COP(=O)([O-])[O-])c3cc(F)ccc23)n1.[Na+].[Na+] |
| InChI | InChI=1S/C16H16FN2O6PS.2Na/c1-2-14(20)12-7-27-16(18-12)15(21)11-6-19(8-25-26(22,23)24)13-5-9(17)3-4-10(11)13;;/h3-7,14,20H,2,8H2,1H3,(H2,22,23,24);;/q;2*+1/p-2/t14-;;/m0../s1 |
| InChIKey | ZYRWXYBGHPMPOK-UTLKBRERSA-L |
| XLogP | -4.28 |
| TPSA | 127.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|