C18H17FN2OS — CID 58217526
1-[6-fluoro-1-(3-methylbut-2-enyl)indol-3-yl]-2-(1,3-thiazol-2-yl)ethanone (PubChem CID 58217526) has the molecular formula C18H17FN2OS and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-[6-fluoro-1-(3-methylbut-2-enyl)indol-3-yl]-2-(1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-[6-fluoro-1-(3-methylbut-2-enyl)indol-3-yl]-2-(1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 58217526 |
| Molecular Formula | C18H17FN2OS |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 1-[6-fluoro-1-(3-methylbut-2-enyl)indol-3-yl]-2-(1,3-thiazol-2-yl)ethanone |
| SMILES | CC(C)=CCn1cc(C(=O)Cc2nccs2)c2ccc(F)cc21 |
| InChI | InChI=1S/C18H17FN2OS/c1-12(2)5-7-21-11-15(14-4-3-13(19)9-16(14)21)17(22)10-18-20-6-8-23-18/h3-6,8-9,11H,7,10H2,1-2H3 |
| InChIKey | KOHXGLHKOZLLQV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|