C12H8N2OS — CID 69252541
1H-indol-3-yl(1,3-thiazol-2-yl)methanone (PubChem CID 69252541) has the molecular formula C12H8N2OS and a molecular weight of 228.28 g/mol. Its IUPAC name is 1H-indol-3-yl(1,3-thiazol-2-yl)methanone.
| Compound Name | 1H-indol-3-yl(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 69252541 |
| Molecular Formula | C12H8N2OS |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 1H-indol-3-yl(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1nccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H8N2OS/c15-11(12-13-5-6-16-12)9-7-14-10-4-2-1-3-8(9)10/h1-7,14H |
| InChIKey | DFYPIVYFSGGXGT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |