C15H12N2O2S — CID 156795885
1-[2-(1H-indole-3-carbonyl)-5-methyl-1,3-thiazol-4-yl]ethanone (PubChem CID 156795885) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-[2-(1H-indole-3-carbonyl)-5-methyl-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(1H-indole-3-carbonyl)-5-methyl-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 156795885 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 1-[2-(1H-indole-3-carbonyl)-5-methyl-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1nc(C(=O)c2c[nH]c3ccccc23)sc1C |
| InChI | InChI=1S/C15H12N2O2S/c1-8(18)13-9(2)20-15(17-13)14(19)11-7-16-12-6-4-3-5-10(11)12/h3-7,16H,1-2H3 |
| InChIKey | BACBQJBWBIJDEG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |