C23H30N3O3S+ — CID 156795825
(1,1-dimethylpiperidin-1-ium-4-yl) 2-(1H-indole-3-carbonyl)-5-methyl-1,3-thiazole-4-carboxylate;ethane (PubChem CID 156795825) has the molecular formula C23H30N3O3S+ and a molecular weight of 428.58 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) 2-(1H-indole-3-carbonyl)-5-methyl-1,3-thiazole-4-carboxylate;ethane.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) 2-(1H-indole-3-carbonyl)-5-methyl-1,3-thiazole-4-carboxylate;ethane |
|---|---|
| PubChem CID | 156795825 |
| Molecular Formula | C23H30N3O3S+ |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) 2-(1H-indole-3-carbonyl)-5-methyl-1,3-thiazole-4-carboxylate;ethane |
| SMILES | CC.Cc1sc(C(=O)c2c[nH]c3ccccc23)nc1C(=O)OC1CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C21H23N3O3S.C2H6/c1-13-18(21(26)27-14-8-10-24(2,3)11-9-14)23-20(28-13)19(25)16-12-22-17-7-5-4-6-15(16)17;1-2/h4-7,12,14H,8-11H2,1-3H3;1-2H3/p+1 |
| InChIKey | KLYNJRZGDGVHBM-UHFFFAOYSA-O |
| XLogP | 4.59 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|