C19H22N3O3S+ — CID 161203911
2-[2-(1H-indole-3-carbonyl)-5-methyl-1,3-thiazole-4-carbonyl]oxyethyl-trimethylazanium (PubChem CID 161203911) has the molecular formula C19H22N3O3S+ and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[2-(1H-indole-3-carbonyl)-5-methyl-1,3-thiazole-4-carbonyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2-(1H-indole-3-carbonyl)-5-methyl-1,3-thiazole-4-carbonyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 161203911 |
| Molecular Formula | C19H22N3O3S+ |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-[2-(1H-indole-3-carbonyl)-5-methyl-1,3-thiazole-4-carbonyl]oxyethyl-trimethylazanium |
| SMILES | Cc1sc(C(=O)c2c[nH]c3ccccc23)nc1C(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C19H21N3O3S/c1-12-16(19(24)25-10-9-22(2,3)4)21-18(26-12)17(23)14-11-20-15-8-6-5-7-13(14)15/h5-8,11H,9-10H2,1-4H3/p+1 |
| InChIKey | CHGJLCLXTFKCBW-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|