C19H21N3O4S — CID 156515524
2-[2-(dimethylamino)ethoxy]ethyl 2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylate (PubChem CID 156515524) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy]ethyl 2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylate.
| Compound Name | 2-[2-(dimethylamino)ethoxy]ethyl 2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 156515524 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy]ethyl 2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylate |
| SMILES | CN(C)CCOCCOC(=O)c1csc(C(=O)c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C19H21N3O4S/c1-22(2)7-8-25-9-10-26-19(24)16-12-27-18(21-16)17(23)14-11-20-15-6-4-3-5-13(14)15/h3-6,11-12,20H,7-10H2,1-2H3 |
| InChIKey | VAOXDQRMOVYCQN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|