C15H14N4O4S2 — CID 139497197
methyl 2-[(Z)-C-(1H-indol-3-yl)-N-(methanesulfonamido)carbonimidoyl]-1,3-thiazole-4-carboxylate (PubChem CID 139497197) has the molecular formula C15H14N4O4S2 and a molecular weight of 378.44 g/mol. Its IUPAC name is methyl 2-[(Z)-C-(1H-indol-3-yl)-N-(methanesulfonamido)carbonimidoyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[(Z)-C-(1H-indol-3-yl)-N-(methanesulfonamido)carbonimidoyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 139497197 |
| Molecular Formula | C15H14N4O4S2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | methyl 2-[(Z)-C-(1H-indol-3-yl)-N-(methanesulfonamido)carbonimidoyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(/C(=N\NS(C)(=O)=O)c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C15H14N4O4S2/c1-23-15(20)12-8-24-14(17-12)13(18-19-25(2,21)22)10-7-16-11-6-4-3-5-9(10)11/h3-8,16,19H,1-2H3/b18-13- |
| InChIKey | WDRRHFJQUOFGAB-AQTBWJFISA-N |
| XLogP | 1.71 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|