C14H10IN3O5S — CID 156795876
methyl 2-[6-[hydroxy(iodosyl)amino]-1H-indole-3-carbonyl]-1,3-thiazole-4-carboxylate (PubChem CID 156795876) has the molecular formula C14H10IN3O5S and a molecular weight of 459.22 g/mol. Its IUPAC name is methyl 2-[6-[hydroxy(iodosyl)amino]-1H-indole-3-carbonyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[6-[hydroxy(iodosyl)amino]-1H-indole-3-carbonyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 156795876 |
| Molecular Formula | C14H10IN3O5S |
| Molecular Weight | 459.22 g/mol |
| Exact Mass | 458.94 |
| IUPAC Name | methyl 2-[6-[hydroxy(iodosyl)amino]-1H-indole-3-carbonyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(C(=O)c2c[nH]c3cc(N(O)I=O)ccc23)n1 |
| InChI | InChI=1S/C14H10IN3O5S/c1-23-14(20)11-6-24-13(17-11)12(19)9-5-16-10-4-7(18(22)15-21)2-3-8(9)10/h2-6,16,22H,1H3 |
| InChIKey | OJHARHKMFGEHKQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|