C13H10N2OS — CID 146238804
1H-indol-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone (PubChem CID 146238804) has the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. Its IUPAC name is 1H-indol-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone.
| Compound Name | 1H-indol-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 146238804 |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 1H-indol-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone |
| SMILES | Cc1csc(C(=O)c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C13H10N2OS/c1-8-7-17-13(15-8)12(16)10-6-14-11-5-3-2-4-9(10)11/h2-7,14H,1H3 |
| InChIKey | DNXUUYBYZBXLKA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |